C23H36O7 — CID 11618713
ethyl 2-[(3aS,4R,5aR,8S,9R,9aR,9bR)-4-(methoxymethoxy)-8,9a-dimethyl-6-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,2'-1,3-dioxolane]-9-yl]acetate (PubChem CID 11618713) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is ethyl 2-[(3aS,4R,5aR,8S,9R,9aR,9bR)-4-(methoxymethoxy)-8,9a-dimethyl-6-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,2'-1,3-dioxolane]-9-yl]acetate.
| Compound Name | ethyl 2-[(3aS,4R,5aR,8S,9R,9aR,9bR)-4-(methoxymethoxy)-8,9a-dimethyl-6-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,2'-1,3-dioxolane]-9-yl]acetate |
|---|---|
| PubChem CID | 11618713 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | ethyl 2-[(3aS,4R,5aR,8S,9R,9aR,9bR)-4-(methoxymethoxy)-8,9a-dimethyl-6-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,2'-1,3-dioxolane]-9-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H](C)CC(=O)[C@@H]2C[C@@H](OCOC)[C@H]3CC4(C[C@H]3[C@@]12C)OCCO4 |
| InChI | InChI=1S/C23H36O7/c1-5-27-21(25)10-16-14(2)8-19(24)17-9-20(28-13-26-4)15-11-23(29-6-7-30-23)12-18(15)22(16,17)3/h14-18,20H,5-13H2,1-4H3/t14-,15-,16+,17-,18+,20+,22-/m0/s1 |
| InChIKey | NBORZGPMNJPOOB-KIAOQGOUSA-N |
| XLogP | 2.95 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|