C25H24N2O5S2 — CID 1161875
methyl 2-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate (PubChem CID 1161875) has the molecular formula C25H24N2O5S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is methyl 2-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 1161875 |
| Molecular Formula | C25H24N2O5S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | methyl 2-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3cccs3)S(=O)(=O)c3ccccc3C(=O)OC)cc2c1 |
| InChI | InChI=1S/C25H24N2O5S2/c1-3-17-10-11-22-18(13-17)14-19(24(28)26-22)15-27(16-20-7-6-12-33-20)34(30,31)23-9-5-4-8-21(23)25(29)32-2/h4-14H,3,15-16H2,1-2H3,(H,26,28) |
| InChIKey | GCOWEIVTWKBOKM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |