About ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate
ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 11618923) has the molecular formula C21H24F2N4O4
and a molecular weight of 434.44 g/mol. Its IUPAC name is ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| PubChem CID | 11618923 |
| Molecular Formula | C21H24F2N4O4 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(C(=O)c3c(OC)ccc(F)c3F)c(N)n2)CC1 |
| InChI | InChI=1S/C21H24F2N4O4/c1-3-31-21(29)27-10-8-12(9-11-27)25-16-7-4-13(20(24)26-16)19(28)17-15(30-2)6-5-14(22)18(17)23/h4-7,12H,3,8-11H2,1-2H3,(H3,24,25,26) |
| InChIKey | YQWWMHZQSOTZTQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate (CID 11618923) is ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate is CCOC(=O)N1CCC(Nc2ccc(C(=O)c3c(OC)ccc(F)c3F)c(N)n2)CC1.
What is the InChIKey of ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate?
The InChIKey is YQWWMHZQSOTZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N4O4/c1-3-31-21(29)27-10-8-12(9-11-27)25-16-7-4-13(20(24)26-16)19(28)17-15(30-2)6-5-14(22)18(17)23/h4-7,12H,3,8-11H2,1-2H3,(H3,24,25,26).
What are the key properties of ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate?
ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate has a molecular weight of 434.44 g/mol, XLogP of 3.21, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[6-amino-5-(2,3-difluoro-6-methoxybenzoyl)-2-pyridinyl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 11618923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).