C25H40O6 — CID 11618977
[(5R,6S,8S,9S,10R,11R)-2-[(2S)-butan-2-yl]-3,5,9,11-tetramethyl-4-oxo-8-[(2S)-1-oxopropan-2-yl]-1,7-dioxaspiro[5.5]undec-2-en-10-yl] 3-methylbutanoate (PubChem CID 11618977) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(5R,6S,8S,9S,10R,11R)-2-[(2S)-butan-2-yl]-3,5,9,11-tetramethyl-4-oxo-8-[(2S)-1-oxopropan-2-yl]-1,7-dioxaspiro[5.5]undec-2-en-10-yl] 3-methylbutanoate.
| Compound Name | [(5R,6S,8S,9S,10R,11R)-2-[(2S)-butan-2-yl]-3,5,9,11-tetramethyl-4-oxo-8-[(2S)-1-oxopropan-2-yl]-1,7-dioxaspiro[5.5]undec-2-en-10-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 11618977 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(5R,6S,8S,9S,10R,11R)-2-[(2S)-butan-2-yl]-3,5,9,11-tetramethyl-4-oxo-8-[(2S)-1-oxopropan-2-yl]-1,7-dioxaspiro[5.5]undec-2-en-10-yl] 3-methylbutanoate |
| SMILES | CC[C@H](C)C1=C(C)C(=O)[C@@H](C)[C@]2(O1)O[C@H]([C@H](C)C=O)[C@H](C)[C@@H](OC(=O)CC(C)C)[C@H]2C |
| InChI | InChI=1S/C25H40O6/c1-10-14(4)22-16(6)21(28)18(8)25(30-22)19(9)24(29-20(27)11-13(2)3)17(7)23(31-25)15(5)12-26/h12-15,17-19,23-24H,10-11H2,1-9H3/t14-,15+,17-,18+,19+,23+,24+,25-/m0/s1 |
| InChIKey | AQRVQSIUBWKLRF-XRLPMCNRSA-N |
| XLogP | 4.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|