C20H22O11 — CID 11619012
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxan-2-yl]methyl acetate (PubChem CID 11619012) has the molecular formula C20H22O11 and a molecular weight of 438.39 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11619012 |
| Molecular Formula | C20H22O11 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C2=CC(=O)C=CC2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H22O11/c1-9(21)27-8-16-18(28-10(2)22)20(30-12(4)24)19(29-11(3)23)17(31-16)14-7-13(25)5-6-15(14)26/h5-7,16-20H,8H2,1-4H3/t16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | OHLZMWIDRXDQHP-RMMWZPCPSA-N |
| XLogP | -0.25 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|