C17H15ClFN4O+ — CID 11619086
1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazol-4-ium-4-amine (PubChem CID 11619086) has the molecular formula C17H15ClFN4O+ and a molecular weight of 345.79 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazol-4-ium-4-amine.
| Compound Name | 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazol-4-ium-4-amine |
|---|---|
| PubChem CID | 11619086 |
| Molecular Formula | C17H15ClFN4O+ |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazol-4-ium-4-amine |
| SMILES | N[n+]1cnn(CC2(c3ccc(F)cc3)OC2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClFN4O/c18-15-4-2-1-3-14(15)16-17(24-16,9-23-11-22(20)10-21-23)12-5-7-13(19)8-6-12/h1-8,10-11,16H,9,20H2/q+1 |
| InChIKey | LBUFYWPJNJQYAM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|