C30H22N2O2 — CID 11619127
(1R,2R,3R,3aS,8bS)-1,3-dipyridin-2-ylspiro[1,3,3a,8b-tetrahydrocyclopenta[a]indene-2,2'-3H-indene]-1',4-dione (PubChem CID 11619127) has the molecular formula C30H22N2O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is (1R,2R,3R,3aS,8bS)-1,3-dipyridin-2-ylspiro[1,3,3a,8b-tetrahydrocyclopenta[a]indene-2,2'-3H-indene]-1',4-dione.
| Compound Name | (1R,2R,3R,3aS,8bS)-1,3-dipyridin-2-ylspiro[1,3,3a,8b-tetrahydrocyclopenta[a]indene-2,2'-3H-indene]-1',4-dione |
|---|---|
| PubChem CID | 11619127 |
| Molecular Formula | C30H22N2O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (1R,2R,3R,3aS,8bS)-1,3-dipyridin-2-ylspiro[1,3,3a,8b-tetrahydrocyclopenta[a]indene-2,2'-3H-indene]-1',4-dione |
| SMILES | O=C1c2ccccc2[C@@H]2[C@H]1[C@@H](c1ccccn1)[C@@]1(Cc3ccccc3C1=O)[C@@H]2c1ccccn1 |
| InChI | InChI=1S/C30H22N2O2/c33-28-21-12-4-3-11-20(21)24-25(28)27(23-14-6-8-16-32-23)30(26(24)22-13-5-7-15-31-22)17-18-9-1-2-10-19(18)29(30)34/h1-16,24-27H,17H2/t24-,25+,26-,27-,30-/m1/s1 |
| InChIKey | XYAWNNSMDMIZGQ-ZOEWFFTDSA-N |
| XLogP | 5.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |