C25H30O5S — CID 11619137
(Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid (PubChem CID 11619137) has the molecular formula C25H30O5S and a molecular weight of 442.58 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 11619137 |
| Molecular Formula | C25H30O5S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-6-oxocyclohexyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)CC[C@@H](O)[C@@H]1/C=C/C(O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C25H30O5S/c26-18(15-17-16-31-24-9-6-5-7-19(17)24)11-12-21-20(22(27)13-14-23(21)28)8-3-1-2-4-10-25(29)30/h1,3,5-7,9,11-12,16,18,20-21,23,26,28H,2,4,8,10,13-15H2,(H,29,30)/b3-1-,12-11+/t18?,20-,21-,23-/m1/s1 |
| InChIKey | GACJXSNXHABDRY-UCJXOOEISA-N |
| XLogP | 4.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|