About [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide (PubChem CID 11619197) has the molecular formula C23H29BrN2O2
and a molecular weight of 445.40 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide.
Molecular Properties
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide |
| PubChem CID | 11619197 |
| Molecular Formula | C23H29BrN2O2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)N(Cc1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C23H29N2O2.BrH/c1-25(2)20-13-14-21(25)16-22(15-20)27-23(26)24(19-11-7-4-8-12-19)17-18-9-5-3-6-10-18;/h3-12,20-22H,13-17H2,1-2H3;1H/q+1;/p-1/t20-,21+,22?; |
| InChIKey | NCLBMDHPOPEBAH-RYTRYILZSA-M |
| XLogP | 1.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide?
The IUPAC name of [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide (CID 11619197) is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide.
What is the SMILES notation for [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide?
The canonical SMILES for [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide is C[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)N(Cc1ccccc1)c1ccccc1)C2.[Br-].
What is the InChIKey of [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide?
The InChIKey is NCLBMDHPOPEBAH-RYTRYILZSA-M. The full InChI is InChI=1S/C23H29N2O2.BrH/c1-25(2)20-13-14-21(25)16-22(15-20)27-23(26)24(19-11-7-4-8-12-19)17-18-9-5-3-6-10-18;/h3-12,20-22H,13-17H2,1-2H3;1H/q+1;/p-1/t20-,21+,22?;.
What are the key properties of [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide?
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide has a molecular weight of 445.40 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-benzyl-N-phenylcarbamate bromide is sourced from PubChem (CID 11619197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).