C20H31NO10 — CID 11619204
methyl (2R,3aR,6S,7aR)-6-acetyloxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11619204) has the molecular formula C20H31NO10 and a molecular weight of 445.47 g/mol. Its IUPAC name is methyl (2R,3aR,6S,7aR)-6-acetyloxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,6S,7aR)-6-acetyloxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11619204 |
| Molecular Formula | C20H31NO10 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | methyl (2R,3aR,6S,7aR)-6-acetyloxy-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OC[C@@H](OC(C)=O)C[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO10/c1-11(22)29-12-7-14-15(28-10-12)9-20(30-14,17(24)27-6)8-13(16(23)26-5)21-18(25)31-19(2,3)4/h12-15H,7-10H2,1-6H3,(H,21,25)/t12-,13-,14+,15+,20+/m0/s1 |
| InChIKey | IGUCGLCFEWSFQX-AHGCTEEOSA-N |
| XLogP | 0.86 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|