C24H22N4O3S — CID 11619237
3-pyridin-2-ylpropyl 2-benzamido-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 11619237) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-pyridin-2-ylpropyl 2-benzamido-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | 3-pyridin-2-ylpropyl 2-benzamido-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 11619237 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-pyridin-2-ylpropyl 2-benzamido-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | N#Cc1c(NC(=O)c2ccccc2)sc2c1CCN(C(=O)OCCCc1ccccn1)C2 |
| InChI | InChI=1S/C24H22N4O3S/c25-15-20-19-11-13-28(24(30)31-14-6-10-18-9-4-5-12-26-18)16-21(19)32-23(20)27-22(29)17-7-2-1-3-8-17/h1-5,7-9,12H,6,10-11,13-14,16H2,(H,27,29) |
| InChIKey | IHMBAXMDEKDFTR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|