C30H33N3O3 — CID 11620005
4-(3,4-dimethylphenoxy)-3-[[(E)-3-phenylprop-2-enoyl]amino]-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 11620005) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-3-[[(E)-3-phenylprop-2-enoyl]amino]-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | 4-(3,4-dimethylphenoxy)-3-[[(E)-3-phenylprop-2-enoyl]amino]-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 11620005 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-3-[[(E)-3-phenylprop-2-enoyl]amino]-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | Cc1ccc(Oc2ccc(C(=O)NCCN3CCCC3)cc2NC(=O)/C=C/c2ccccc2)cc1C |
| InChI | InChI=1S/C30H33N3O3/c1-22-10-13-26(20-23(22)2)36-28-14-12-25(30(35)31-16-19-33-17-6-7-18-33)21-27(28)32-29(34)15-11-24-8-4-3-5-9-24/h3-5,8-15,20-21H,6-7,16-19H2,1-2H3,(H,31,35)(H,32,34)/b15-11+ |
| InChIKey | NERZZHAUEVWREN-RVDMUPIBSA-N |
| XLogP | 5.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|