C28H28ClNO5 — CID 11620184
(1R,2R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-ethoxy-1,8b-dihydroxy-N,N-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 11620184) has the molecular formula C28H28ClNO5 and a molecular weight of 493.99 g/mol. Its IUPAC name is (1R,2R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-ethoxy-1,8b-dihydroxy-N,N-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (1R,2R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-ethoxy-1,8b-dihydroxy-N,N-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 11620184 |
| Molecular Formula | C28H28ClNO5 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (1R,2R,3S,3aR,8bS)-3a-(4-chlorophenyl)-6-ethoxy-1,8b-dihydroxy-N,N-dimethyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2c(c1)O[C@@]1(c3ccc(Cl)cc3)[C@H](c3ccccc3)[C@@H](C(=O)N(C)C)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C28H28ClNO5/c1-4-34-20-14-15-21-22(16-20)35-28(18-10-12-19(29)13-11-18)24(17-8-6-5-7-9-17)23(26(32)30(2)3)25(31)27(21,28)33/h5-16,23-25,31,33H,4H2,1-3H3/t23-,24-,25-,27+,28+/m1/s1 |
| InChIKey | FFQZXGYVGQZFJW-YQAJTNRGSA-N |
| XLogP | 4.08 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |