C26H24F3N5O2 — CID 11620207
5-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-methoxy-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 11620207) has the molecular formula C26H24F3N5O2 and a molecular weight of 495.51 g/mol. Its IUPAC name is 5-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-methoxy-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-methoxy-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 11620207 |
| Molecular Formula | C26H24F3N5O2 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 5-[2-(2-aminopyrimidin-5-yl)ethynyl]-2-methoxy-N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccc(C#Cc2cnc(N)nc2)cc1C(=O)Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| InChI | InChI=1S/C26H24F3N5O2/c1-36-23-10-7-17(5-6-18-15-31-25(30)32-16-18)13-20(23)24(35)33-21-14-19(26(27,28)29)8-9-22(21)34-11-3-2-4-12-34/h7-10,13-16H,2-4,11-12H2,1H3,(H,33,35)(H2,30,31,32) |
| InChIKey | RRZDLEADQGXQKI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|