C20H23F6N3O5 — CID 11620278
N-[(2R,3S)-7-fluoro-5-(2-hydroxyethyl)-2-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-2,2-dimethyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide (PubChem CID 11620278) has the molecular formula C20H23F6N3O5 and a molecular weight of 499.41 g/mol. Its IUPAC name is N-[(2R,3S)-7-fluoro-5-(2-hydroxyethyl)-2-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-2,2-dimethyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide.
| Compound Name | N-[(2R,3S)-7-fluoro-5-(2-hydroxyethyl)-2-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-2,2-dimethyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
|---|---|
| PubChem CID | 11620278 |
| Molecular Formula | C20H23F6N3O5 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N-[(2R,3S)-7-fluoro-5-(2-hydroxyethyl)-2-methyl-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-2,2-dimethyl-N'-(2,2,3,3,3-pentafluoropropyl)propanediamide |
| SMILES | C[C@H]1Oc2ccc(F)cc2N(CCO)C(=O)[C@H]1NC(=O)C(C)(C)C(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H23F6N3O5/c1-10-14(15(31)29(6-7-30)12-8-11(21)4-5-13(12)34-10)28-17(33)18(2,3)16(32)27-9-19(22,23)20(24,25)26/h4-5,8,10,14,30H,6-7,9H2,1-3H3,(H,27,32)(H,28,33)/t10-,14+/m1/s1 |
| InChIKey | HSXNTNNHZUDLHU-YGRLFVJLSA-N |
| XLogP | 1.76 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|