C22H23F3N2O7S — CID 11620535
2-(2-methoxy-5-methylphenyl)-7-piperazin-1-yl-1-benzofuran-5-sulfonic acid;2,2,2-trifluoroacetic acid (PubChem CID 11620535) has the molecular formula C22H23F3N2O7S and a molecular weight of 516.49 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylphenyl)-7-piperazin-1-yl-1-benzofuran-5-sulfonic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-methoxy-5-methylphenyl)-7-piperazin-1-yl-1-benzofuran-5-sulfonic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11620535 |
| Molecular Formula | C22H23F3N2O7S |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 2-(2-methoxy-5-methylphenyl)-7-piperazin-1-yl-1-benzofuran-5-sulfonic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C)cc1-c1cc2cc(S(=O)(=O)O)cc(N3CCNCC3)c2o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22N2O5S.C2HF3O2/c1-13-3-4-18(26-2)16(9-13)19-11-14-10-15(28(23,24)25)12-17(20(14)27-19)22-7-5-21-6-8-22;3-2(4,5)1(6)7/h3-4,9-12,21H,5-8H2,1-2H3,(H,23,24,25);(H,6,7) |
| InChIKey | RTWBOXRCPHGLNA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|