C31H39N3O4 — CID 11620555
(3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-(2-pyridin-2-ylethynyl)phenyl]methyl]-N-[(2R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide (PubChem CID 11620555) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is (3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-(2-pyridin-2-ylethynyl)phenyl]methyl]-N-[(2R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-(2-pyridin-2-ylethynyl)phenyl]methyl]-N-[(2R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 11620555 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | (3S,4R,5R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[[3-(2-pyridin-2-ylethynyl)phenyl]methyl]-N-[(2R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
| SMILES | C[C@H](O)[C@@H]1[C@H](CO)ON(Cc2cccc(C#Cc3ccccn3)c2)[C@@H]1C(=O)N[C@H]1CC2CC([C@H]1C)C2(C)C |
| InChI | InChI=1S/C31H39N3O4/c1-19-25-15-23(31(25,3)4)16-26(19)33-30(37)29-28(20(2)36)27(18-35)38-34(29)17-22-9-7-8-21(14-22)11-12-24-10-5-6-13-32-24/h5-10,13-14,19-20,23,25-29,35-36H,15-18H2,1-4H3,(H,33,37)/t19-,20+,23?,25?,26+,27+,28-,29+/m1/s1 |
| InChIKey | WWWPSLGJQYNANH-GFDOZPBBSA-N |
| XLogP | 3.14 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|