C30H54O4Si2 — CID 11620772
[(1S,1aR,3R,7bS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-3,6-dimethyl-1-propyl-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalen-1-yl]methanol (PubChem CID 11620772) has the molecular formula C30H54O4Si2 and a molecular weight of 534.93 g/mol. Its IUPAC name is [(1S,1aR,3R,7bS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-3,6-dimethyl-1-propyl-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalen-1-yl]methanol.
| Compound Name | [(1S,1aR,3R,7bS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-3,6-dimethyl-1-propyl-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 11620772 |
| Molecular Formula | C30H54O4Si2 |
| Molecular Weight | 534.93 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | [(1S,1aR,3R,7bS)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-3,6-dimethyl-1-propyl-1a,2,3,7b-tetrahydrocyclopropa[a]naphthalen-1-yl]methanol |
| SMILES | CCC[C@]1(CO)[C@@H]2C[C@@H](C)c3c(O[Si](C)(C)C(C)(C)C)c(OC)c(C)c(O[Si](C)(C)C(C)(C)C)c3[C@@H]21 |
| InChI | InChI=1S/C30H54O4Si2/c1-15-16-30(18-31)21-17-19(2)22-23(24(21)30)25(33-35(11,12)28(4,5)6)20(3)26(32-10)27(22)34-36(13,14)29(7,8)9/h19,21,24,31H,15-18H2,1-14H3/t19-,21-,24-,30+/m1/s1 |
| InChIKey | WZXLZPLDZYTLKL-ZQBOKOOXSA-N |
| XLogP | 8.77 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.93 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|