C27H35N9O3S — CID 11621082
4-[[3-[3-(butylsulfamoyl)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 11621082) has the molecular formula C27H35N9O3S and a molecular weight of 565.70 g/mol. Its IUPAC name is 4-[[3-[3-(butylsulfamoyl)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[[3-[3-(butylsulfamoyl)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 11621082 |
| Molecular Formula | C27H35N9O3S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 4-[[3-[3-(butylsulfamoyl)phenyl]triazolo[4,5-d]pyrimidin-5-yl]amino]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(-n2nnc3cnc(Nc4ccc(C(=O)NCCN(CC)CC)cc4)nc32)c1 |
| InChI | InChI=1S/C27H35N9O3S/c1-4-7-15-30-40(38,39)23-10-8-9-22(18-23)36-25-24(33-34-36)19-29-27(32-25)31-21-13-11-20(12-14-21)26(37)28-16-17-35(5-2)6-3/h8-14,18-19,30H,4-7,15-17H2,1-3H3,(H,28,37)(H,29,31,32) |
| InChIKey | IOYWOOWPJUXQRO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|