C29H27F5N6OS — CID 11621352
8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(1,1,2,2,2-pentafluoroethyl)-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine (PubChem CID 11621352) has the molecular formula C29H27F5N6OS and a molecular weight of 602.63 g/mol. Its IUPAC name is 8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(1,1,2,2,2-pentafluoroethyl)-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine.
| Compound Name | 8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(1,1,2,2,2-pentafluoroethyl)-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine |
|---|---|
| PubChem CID | 11621352 |
| Molecular Formula | C29H27F5N6OS |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | 8-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-(1,1,2,2,2-pentafluoroethyl)-6,7,9,10-tetrahydro-[1,3]oxazolo[5,4-i][3]benzazepine |
| SMILES | Cc1ccc2c(-c3nnc(SCCCN4CCc5ccc6oc(C(F)(F)C(F)(F)F)nc6c5CC4)n3C)cccc2n1 |
| InChI | InChI=1S/C29H27F5N6OS/c1-17-7-9-20-21(5-3-6-22(20)35-17)25-37-38-27(39(25)2)42-16-4-13-40-14-11-18-8-10-23-24(19(18)12-15-40)36-26(41-23)28(30,31)29(32,33)34/h3,5-10H,4,11-16H2,1-2H3 |
| InChIKey | YJTUMJAALUNJJT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|