C30H25N5O8S — CID 11621434
3,7-bis(2,4-dinitrophenyl)-10-hexylphenothiazine (PubChem CID 11621434) has the molecular formula C30H25N5O8S and a molecular weight of 615.62 g/mol. Its IUPAC name is 3,7-bis(2,4-dinitrophenyl)-10-hexylphenothiazine.
| Compound Name | 3,7-bis(2,4-dinitrophenyl)-10-hexylphenothiazine |
|---|---|
| PubChem CID | 11621434 |
| Molecular Formula | C30H25N5O8S |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | 3,7-bis(2,4-dinitrophenyl)-10-hexylphenothiazine |
| SMILES | CCCCCCN1c2ccc(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2Sc2cc(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C30H25N5O8S/c1-2-3-4-5-14-31-25-12-6-19(23-10-8-21(32(36)37)17-27(23)34(40)41)15-29(25)44-30-16-20(7-13-26(30)31)24-11-9-22(33(38)39)18-28(24)35(42)43/h6-13,15-18H,2-5,14H2,1H3 |
| InChIKey | XPRIVFNLEGOZFX-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|