C37H41N5O6 — CID 11621612
(E)-3-[4-[[1-[[3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(1,3-oxazol-5-yl)indole-6-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 11621612) has the molecular formula C37H41N5O6 and a molecular weight of 651.76 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(1,3-oxazol-5-yl)indole-6-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(1,3-oxazol-5-yl)indole-6-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11621612 |
| Molecular Formula | C37H41N5O6 |
| Molecular Weight | 651.76 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclohexyl-1-[2-(dimethylamino)-2-oxoethyl]-2-(1,3-oxazol-5-yl)indole-6-carbonyl]amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)C(=O)Cn1c(-c2cnco2)c(C2CCCCC2)c2ccc(C(=O)NC3(C(=O)Nc4ccc(/C=C/C(=O)O)cc4)CCCC3)cc21 |
| InChI | InChI=1S/C37H41N5O6/c1-41(2)31(43)22-42-29-20-26(13-16-28(29)33(25-8-4-3-5-9-25)34(42)30-21-38-23-48-30)35(46)40-37(18-6-7-19-37)36(47)39-27-14-10-24(11-15-27)12-17-32(44)45/h10-17,20-21,23,25H,3-9,18-19,22H2,1-2H3,(H,39,47)(H,40,46)(H,44,45)/b17-12+ |
| InChIKey | LERDFDBOKHNZHX-SFQUDFHCSA-N |
| XLogP | 6.21 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|