About CID 11622257
CID 11622257 (PubChem CID 11622257) has the molecular formula C36H24
and a molecular weight of 456.59 g/mol.
Molecular Properties
| Compound Name | CID 11622257 |
| PubChem CID | 11622257 |
| Molecular Formula | C36H24 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](c2c([C]3[CH][CH][CH][CH]3)c([C]3[CH][CH][CH][CH]3)c([C]3[CH][CH][CH][CH]3)c([C]3[CH][CH][CH][CH]3)c2[C]2[CH][CH][CH][CH]2)[CH]1 |
| InChI | InChI=1S/C36H24/c1-2-14-25(13-1)31-32(26-15-3-4-16-26)34(28-19-7-8-20-28)36(30-23-11-12-24-30)35(29-21-9-10-22-29)33(31)27-17-5-6-18-27/h1-24H |
| InChIKey | HTOOGZBAZGTFAQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11622257 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11622257?
The IUPAC name of CID 11622257 (CID 11622257) is not available.
What is the SMILES notation for CID 11622257?
The canonical SMILES for CID 11622257 is [CH]1[CH][CH][C](c2c([C]3[CH][CH][CH][CH]3)c([C]3[CH][CH][CH][CH]3)c([C]3[CH][CH][CH][CH]3)c([C]3[CH][CH][CH][CH]3)c2[C]2[CH][CH][CH][CH]2)[CH]1.
What is the InChIKey of CID 11622257?
The InChIKey is HTOOGZBAZGTFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H24/c1-2-14-25(13-1)31-32(26-15-3-4-16-26)34(28-19-7-8-20-28)36(30-23-11-12-24-30)35(29-21-9-10-22-29)33(31)27-17-5-6-18-27/h1-24H.
What are the key properties of CID 11622257?
CID 11622257 has a molecular weight of 456.59 g/mol, XLogP of 6.21, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11622257 is sourced from PubChem (CID 11622257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).