C14H19NO — CID 11622632
3-[(1S,4aR,8aR)-2-methylidene-6-oxo-1,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]propanenitrile (PubChem CID 11622632) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[(1S,4aR,8aR)-2-methylidene-6-oxo-1,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]propanenitrile.
| Compound Name | 3-[(1S,4aR,8aR)-2-methylidene-6-oxo-1,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]propanenitrile |
|---|---|
| PubChem CID | 11622632 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-[(1S,4aR,8aR)-2-methylidene-6-oxo-1,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]propanenitrile |
| SMILES | C=C1CC[C@@H]2CC(=O)CC[C@H]2[C@@H]1CCC#N |
| InChI | InChI=1S/C14H19NO/c1-10-4-5-11-9-12(16)6-7-14(11)13(10)3-2-8-15/h11,13-14H,1-7,9H2/t11-,13-,14-/m1/s1 |
| InChIKey | ODUBZTJWXMJVTI-MRVWCRGKSA-N |
| XLogP | 3.24 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|