About 3-phenyl-1,3-thiazol-3-ium bromide
3-phenyl-1,3-thiazol-3-ium bromide (PubChem CID 11622852) has the molecular formula C9H8BrNS
and a molecular weight of 242.14 g/mol. Its IUPAC name is 3-phenyl-1,3-thiazol-3-ium bromide.
Molecular Properties
| Compound Name | 3-phenyl-1,3-thiazol-3-ium bromide |
| PubChem CID | 11622852 |
| Molecular Formula | C9H8BrNS |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 240.96 |
| IUPAC Name | 3-phenyl-1,3-thiazol-3-ium bromide |
| SMILES | [Br-].c1ccc(-[n+]2ccsc2)cc1 |
| InChI | InChI=1S/C9H8NS.BrH/c1-2-4-9(5-3-1)10-6-7-11-8-10;/h1-8H;1H/q+1;/p-1 |
| InChIKey | XUMWDPHRECBDLD-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1,3-thiazol-3-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,3-thiazol-3-ium bromide?
The IUPAC name of 3-phenyl-1,3-thiazol-3-ium bromide (CID 11622852) is 3-phenyl-1,3-thiazol-3-ium bromide.
What is the SMILES notation for 3-phenyl-1,3-thiazol-3-ium bromide?
The canonical SMILES for 3-phenyl-1,3-thiazol-3-ium bromide is [Br-].c1ccc(-[n+]2ccsc2)cc1.
What is the InChIKey of 3-phenyl-1,3-thiazol-3-ium bromide?
The InChIKey is XUMWDPHRECBDLD-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8NS.BrH/c1-2-4-9(5-3-1)10-6-7-11-8-10;/h1-8H;1H/q+1;/p-1.
What are the key properties of 3-phenyl-1,3-thiazol-3-ium bromide?
3-phenyl-1,3-thiazol-3-ium bromide has a molecular weight of 242.14 g/mol, XLogP of -0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,3-thiazol-3-ium bromide is sourced from PubChem (CID 11622852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).