About phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol
phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol (PubChem CID 11622956) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol.
Molecular Properties
| Compound Name | phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol |
| PubChem CID | 11622956 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol |
| SMILES | OC(c1ccccc1)c1ncoc1-c1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-15(12-7-3-1-4-8-12)14-16(19-11-17-14)13-9-5-2-6-10-13/h1-11,15,18H |
| InChIKey | COOHTJBKQMLTQC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol?
The IUPAC name of phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol (CID 11622956) is phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol.
What is the SMILES notation for phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol?
The canonical SMILES for phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol is OC(c1ccccc1)c1ncoc1-c1ccccc1.
What is the InChIKey of phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol?
The InChIKey is COOHTJBKQMLTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-15(12-7-3-1-4-8-12)14-16(19-11-17-14)13-9-5-2-6-10-13/h1-11,15,18H.
What are the key properties of phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol?
phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol has a molecular weight of 251.29 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(5-phenyl-1,3-oxazol-4-yl)methanol is sourced from PubChem (CID 11622956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).