C15H18O4 — CID 11623082
5-hydroxy-2,2,8-trimethyl-3,4,8,9-tetrahydropyrano[3,4-g]chromen-6-one (PubChem CID 11623082) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-hydroxy-2,2,8-trimethyl-3,4,8,9-tetrahydropyrano[3,4-g]chromen-6-one.
| Compound Name | 5-hydroxy-2,2,8-trimethyl-3,4,8,9-tetrahydropyrano[3,4-g]chromen-6-one |
|---|---|
| PubChem CID | 11623082 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5-hydroxy-2,2,8-trimethyl-3,4,8,9-tetrahydropyrano[3,4-g]chromen-6-one |
| SMILES | CC1Cc2cc3c(c(O)c2C(=O)O1)CCC(C)(C)O3 |
| InChI | InChI=1S/C15H18O4/c1-8-6-9-7-11-10(4-5-15(2,3)19-11)13(16)12(9)14(17)18-8/h7-8,16H,4-6H2,1-3H3 |
| InChIKey | CXCVRNVJEQJAAZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |