About furan-2-yl-(3,4,5-trimethoxyphenyl)methanol
furan-2-yl-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 11623100) has the molecular formula C14H16O5
and a molecular weight of 264.28 g/mol. Its IUPAC name is furan-2-yl-(3,4,5-trimethoxyphenyl)methanol.
Molecular Properties
| Compound Name | furan-2-yl-(3,4,5-trimethoxyphenyl)methanol |
| PubChem CID | 11623100 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | furan-2-yl-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)c2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16O5/c1-16-11-7-9(8-12(17-2)14(11)18-3)13(15)10-5-4-6-19-10/h4-8,13,15H,1-3H3 |
| InChIKey | SRIMVDYFMIAGIL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze furan-2-yl-(3,4,5-trimethoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-yl-(3,4,5-trimethoxyphenyl)methanol?
The IUPAC name of furan-2-yl-(3,4,5-trimethoxyphenyl)methanol (CID 11623100) is furan-2-yl-(3,4,5-trimethoxyphenyl)methanol.
What is the SMILES notation for furan-2-yl-(3,4,5-trimethoxyphenyl)methanol?
The canonical SMILES for furan-2-yl-(3,4,5-trimethoxyphenyl)methanol is COc1cc(C(O)c2ccco2)cc(OC)c1OC.
What is the InChIKey of furan-2-yl-(3,4,5-trimethoxyphenyl)methanol?
The InChIKey is SRIMVDYFMIAGIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O5/c1-16-11-7-9(8-12(17-2)14(11)18-3)13(15)10-5-4-6-19-10/h4-8,13,15H,1-3H3.
What are the key properties of furan-2-yl-(3,4,5-trimethoxyphenyl)methanol?
furan-2-yl-(3,4,5-trimethoxyphenyl)methanol has a molecular weight of 264.28 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-yl-(3,4,5-trimethoxyphenyl)methanol is sourced from PubChem (CID 11623100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).