About 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile
3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile (PubChem CID 11623136) has the molecular formula C17H21N3
and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile |
| PubChem CID | 11623136 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile |
| SMILES | CCn1cc([C@H]2C[C@@H]2CN(C)C)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C17H21N3/c1-4-20-11-16(14-8-13(14)10-19(2)3)15-7-12(9-18)5-6-17(15)20/h5-7,11,13-14H,4,8,10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | FBYZEHXPWUZCPM-KGLIPLIRSA-N |
| XLogP | 3.20 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile?
The IUPAC name of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile (CID 11623136) is 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile.
What is the SMILES notation for 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile?
The canonical SMILES for 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile is CCn1cc([C@H]2C[C@@H]2CN(C)C)c2cc(C#N)ccc21.
What is the InChIKey of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile?
The InChIKey is FBYZEHXPWUZCPM-KGLIPLIRSA-N. The full InChI is InChI=1S/C17H21N3/c1-4-20-11-16(14-8-13(14)10-19(2)3)15-7-12(9-18)5-6-17(15)20/h5-7,11,13-14H,4,8,10H2,1-3H3/t13-,14+/m1/s1.
What are the key properties of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile?
3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile has a molecular weight of 267.38 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-ethylindole-5-carbonitrile is sourced from PubChem (CID 11623136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).