About 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one
9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one (PubChem CID 11623194) has the molecular formula C13H20O2S2
and a molecular weight of 272.43 g/mol. Its IUPAC name is 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one.
Molecular Properties
| Compound Name | 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one |
| PubChem CID | 11623194 |
| Molecular Formula | C13H20O2S2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one |
| SMILES | C=CCCCCC1CC2(CC(=O)O1)SCCS2 |
| InChI | InChI=1S/C13H20O2S2/c1-2-3-4-5-6-11-9-13(10-12(14)15-11)16-7-8-17-13/h2,11H,1,3-10H2 |
| InChIKey | KIUAMCGSMXGDDJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one?
The IUPAC name of 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one (CID 11623194) is 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one.
What is the SMILES notation for 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one?
The canonical SMILES for 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one is C=CCCCCC1CC2(CC(=O)O1)SCCS2.
What is the InChIKey of 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one?
The InChIKey is KIUAMCGSMXGDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S2/c1-2-3-4-5-6-11-9-13(10-12(14)15-11)16-7-8-17-13/h2,11H,1,3-10H2.
What are the key properties of 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one?
9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one has a molecular weight of 272.43 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hex-5-enyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-one is sourced from PubChem (CID 11623194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).