C20H30O3 — CID 11623865
(2S,4Z)-2-[(E)-2-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]ethenyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 11623865) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2S,4Z)-2-[(E)-2-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]ethenyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2S,4Z)-2-[(E)-2-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]ethenyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 11623865 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S,4Z)-2-[(E)-2-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]ethenyl]-3,6,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CCCCC/C=C\C[C@@H]1O[C@@H]1/C=C/[C@@H]1C/C=C\CCCC(=O)O1 |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-10-13-18-19(23-18)16-15-17-12-9-7-8-11-14-20(21)22-17/h6-7,9-10,15-19H,2-5,8,11-14H2,1H3/b9-7-,10-6-,16-15+/t17-,18-,19+/m0/s1 |
| InChIKey | MWTCCFSVIGUOIH-AYUWUTFTSA-N |
| XLogP | 4.88 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|