About N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide
N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide (PubChem CID 11623958) has the molecular formula C16H22N2O3S
and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide |
| PubChem CID | 11623958 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CC(NC(=O)C1CCCCC1)C2 |
| InChI | InChI=1S/C16H22N2O3S/c17-22(20,21)15-7-6-12-8-14(9-13(12)10-15)18-16(19)11-4-2-1-3-5-11/h6-7,10-11,14H,1-5,8-9H2,(H,18,19)(H2,17,20,21) |
| InChIKey | PUAFUZDTMVHXBP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide?
The IUPAC name of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide (CID 11623958) is N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide.
What is the SMILES notation for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide?
The canonical SMILES for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide is NS(=O)(=O)c1ccc2c(c1)CC(NC(=O)C1CCCCC1)C2.
What is the InChIKey of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide?
The InChIKey is PUAFUZDTMVHXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3S/c17-22(20,21)15-7-6-12-8-14(9-13(12)10-15)18-16(19)11-4-2-1-3-5-11/h6-7,10-11,14H,1-5,8-9H2,(H,18,19)(H2,17,20,21).
What are the key properties of N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide?
N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide has a molecular weight of 322.43 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-sulfamoyl-2,3-dihydro-1H-inden-2-yl)cyclohexanecarboxamide is sourced from PubChem (CID 11623958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).