C16H26BrNO — CID 11624042
[3-bromo-4-[(dibutylamino)methyl]phenyl]methanol (PubChem CID 11624042) has the molecular formula C16H26BrNO and a molecular weight of 328.29 g/mol. Its IUPAC name is [3-bromo-4-[(dibutylamino)methyl]phenyl]methanol.
| Compound Name | [3-bromo-4-[(dibutylamino)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 11624042 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [3-bromo-4-[(dibutylamino)methyl]phenyl]methanol |
| SMILES | CCCCN(CCCC)Cc1ccc(CO)cc1Br |
| InChI | InChI=1S/C16H26BrNO/c1-3-5-9-18(10-6-4-2)12-15-8-7-14(13-19)11-16(15)17/h7-8,11,19H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | HPMXLZGNHVTCNK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |