C16H17N3O5 — CID 11624098
N-propyl-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide (PubChem CID 11624098) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-propyl-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide.
| Compound Name | N-propyl-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 11624098 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-propyl-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
| SMILES | CCCNC(=O)CCC(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O |
| InChI | InChI=1S/C16H17N3O5/c1-2-7-17-12(20)5-6-13(21)18-9-3-4-10-11(8-9)14(22)16(24)19-15(10)23/h3-4,8H,2,5-7H2,1H3,(H,17,20)(H,18,21)(H,19,23,24) |
| InChIKey | ZHRVSZKDLXIFPF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|