C18H15ClN2O3 — CID 11624316
4-(2-chlorophenyl)-6-methyl-1,3-dioxo-3a,4,5,8b-tetrahydropyrrolo[3,4-e]indole-7-carbaldehyde (PubChem CID 11624316) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-6-methyl-1,3-dioxo-3a,4,5,8b-tetrahydropyrrolo[3,4-e]indole-7-carbaldehyde.
| Compound Name | 4-(2-chlorophenyl)-6-methyl-1,3-dioxo-3a,4,5,8b-tetrahydropyrrolo[3,4-e]indole-7-carbaldehyde |
|---|---|
| PubChem CID | 11624316 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-(2-chlorophenyl)-6-methyl-1,3-dioxo-3a,4,5,8b-tetrahydropyrrolo[3,4-e]indole-7-carbaldehyde |
| SMILES | Cn1c(C=O)cc2c1CC(c1ccccc1Cl)C1C(=O)NC(=O)C21 |
| InChI | InChI=1S/C18H15ClN2O3/c1-21-9(8-22)6-12-14(21)7-11(10-4-2-3-5-13(10)19)15-16(12)18(24)20-17(15)23/h2-6,8,11,15-16H,7H2,1H3,(H,20,23,24) |
| InChIKey | OZYHLQNETLWTGP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|