C17H32O5Si — CID 11624354
[(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl] acetate (PubChem CID 11624354) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is [(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl] acetate.
| Compound Name | [(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl] acetate |
|---|---|
| PubChem CID | 11624354 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-6-(2-oxoethyl)oxan-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H](CC=O)O1 |
| InChI | InChI=1S/C17H32O5Si/c1-12(19)20-15-11-14(22-23(7,8)16(2,3)4)17(5,6)13(21-15)9-10-18/h10,13-15H,9,11H2,1-8H3/t13-,14-,15?/m1/s1 |
| InChIKey | XHYICHJUBUUIRX-GRKKQISMSA-N |
| XLogP | 3.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|