C23H20FNO — CID 11624372
N-(4-fluorophenyl)-5,5-diphenylpent-4-enamide (PubChem CID 11624372) has the molecular formula C23H20FNO and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5,5-diphenylpent-4-enamide.
| Compound Name | N-(4-fluorophenyl)-5,5-diphenylpent-4-enamide |
|---|---|
| PubChem CID | 11624372 |
| Molecular Formula | C23H20FNO |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-(4-fluorophenyl)-5,5-diphenylpent-4-enamide |
| SMILES | O=C(CCC=C(c1ccccc1)c1ccccc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FNO/c24-20-14-16-21(17-15-20)25-23(26)13-7-12-22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-12,14-17H,7,13H2,(H,25,26) |
| InChIKey | XXMFOUUVALGCHU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |