About dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate
dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 11624525) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate |
| PubChem CID | 11624525 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | O=C1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H19NO5/c22-17-11-18(19(23)25-13-15-7-3-1-4-8-15)21(12-17)20(24)26-14-16-9-5-2-6-10-16/h1-10,18H,11-14H2/t18-/m0/s1 |
| InChIKey | OVYDXOQNKHZEDW-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate?
The IUPAC name of dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate (CID 11624525) is dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate?
The canonical SMILES for dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate is O=C1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1.
What is the InChIKey of dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate?
The InChIKey is OVYDXOQNKHZEDW-SFHVURJKSA-N. The full InChI is InChI=1S/C20H19NO5/c22-17-11-18(19(23)25-13-15-7-3-1-4-8-15)21(12-17)20(24)26-14-16-9-5-2-6-10-16/h1-10,18H,11-14H2/t18-/m0/s1.
What are the key properties of dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate?
dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate has a molecular weight of 353.37 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 11624525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).