C15H27IOSi — CID 11625060
tert-butyl-[(2E,4Z,6E)-7-iodo-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane (PubChem CID 11625060) has the molecular formula C15H27IOSi and a molecular weight of 378.37 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z,6E)-7-iodo-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z,6E)-7-iodo-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11625060 |
| Molecular Formula | C15H27IOSi |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | tert-butyl-[(2E,4Z,6E)-7-iodo-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane |
| SMILES | CC(=C/C(C)=C/I)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27IOSi/c1-13(11-14(2)12-16)9-8-10-17-18(6,7)15(3,4)5/h8-9,11-12H,10H2,1-7H3/b9-8+,13-11-,14-12+ |
| InChIKey | IFGOKLMEEZOLMR-GNWKEBLTSA-N |
| XLogP | 5.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|