C19H17N3O6 — CID 11625145
dimethyl 4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate (PubChem CID 11625145) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is dimethyl 4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate.
| Compound Name | dimethyl 4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 11625145 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | dimethyl 4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate |
| SMILES | COC(=O)c1nn2c(c1C(=O)OC)CC1C(=O)N(c3ccccc3)C(=O)C1C2 |
| InChI | InChI=1S/C19H17N3O6/c1-27-18(25)14-13-8-11-12(9-21(13)20-15(14)19(26)28-2)17(24)22(16(11)23)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3 |
| InChIKey | OHZVMXWAENSFNY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|