C22H31NO6 — CID 11625597
(4S)-3-[(2S,3R)-3-hydroxy-2-methyl-5-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11625597) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is (4S)-3-[(2S,3R)-3-hydroxy-2-methyl-5-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3R)-3-hydroxy-2-methyl-5-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11625597 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (4S)-3-[(2S,3R)-3-hydroxy-2-methyl-5-[(4R,6R)-2,2,6-trimethyl-1,3-dioxan-4-yl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1C[C@@H](CC[C@@H](O)[C@H](C)C(=O)N2C(=O)OC[C@@H]2c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C22H31NO6/c1-14-12-17(29-22(3,4)28-14)10-11-19(24)15(2)20(25)23-18(13-27-21(23)26)16-8-6-5-7-9-16/h5-9,14-15,17-19,24H,10-13H2,1-4H3/t14-,15+,17-,18-,19-/m1/s1 |
| InChIKey | UWBYXKLKKBOIDC-CSFFLVESSA-N |
| XLogP | 3.41 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |