C22H35NO4Si — CID 11625600
N-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]-2-methoxybenzamide (PubChem CID 11625600) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is N-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]-2-methoxybenzamide.
| Compound Name | N-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 11625600 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-[(E)-8-[tert-butyl(dimethyl)silyl]oxyoct-2-enoyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(=O)/C=C/CCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO4Si/c1-22(2,3)28(5,6)27-17-13-9-7-8-10-16-20(24)23-21(25)18-14-11-12-15-19(18)26-4/h10-12,14-16H,7-9,13,17H2,1-6H3,(H,23,24,25)/b16-10+ |
| InChIKey | OGWOPLAUCTYXCI-MHWRWJLKSA-N |
| XLogP | 5.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|