C17H18F3N3O4S — CID 11625863
1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(trifluoromethoxy)-1,2-benzothiazol-3-yl]methanone;formic acid (PubChem CID 11625863) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is 1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(trifluoromethoxy)-1,2-benzothiazol-3-yl]methanone;formic acid.
| Compound Name | 1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(trifluoromethoxy)-1,2-benzothiazol-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 11625863 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1,4-diazabicyclo[3.2.2]nonan-4-yl-[6-(trifluoromethoxy)-1,2-benzothiazol-3-yl]methanone;formic acid |
| SMILES | O=C(c1nsc2cc(OC(F)(F)F)ccc12)N1CCN2CCC1CC2.O=CO |
| InChI | InChI=1S/C16H16F3N3O2S.CH2O2/c17-16(18,19)24-11-1-2-12-13(9-11)25-20-14(12)15(23)22-8-7-21-5-3-10(22)4-6-21;2-1-3/h1-2,9-10H,3-8H2;1H,(H,2,3) |
| InChIKey | AYVUAQKIHFNWIX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|