C25H23FO5S — CID 11626638
(2S,3R,4R,5S,6R)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11626638) has the molecular formula C25H23FO5S and a molecular weight of 454.52 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11626638 |
| Molecular Formula | C25H23FO5S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3cc4cc(F)ccc4s3)cc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H23FO5S/c26-16-5-6-21-15(10-16)11-17(32-21)8-13-7-14-3-1-2-4-18(14)19(9-13)25-24(30)23(29)22(28)20(12-27)31-25/h1-7,9-11,20,22-25,27-30H,8,12H2/t20-,22-,23+,24-,25+/m1/s1 |
| InChIKey | VDDLOWOBODIIQN-HFBCXCLPSA-N |
| XLogP | 3.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |