C26H23FN2O4S — CID 11627082
2-[3-[6-fluoro-1,1-dioxo-2-(2-phenylethyl)-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid (PubChem CID 11627082) has the molecular formula C26H23FN2O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[3-[6-fluoro-1,1-dioxo-2-(2-phenylethyl)-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[6-fluoro-1,1-dioxo-2-(2-phenylethyl)-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11627082 |
| Molecular Formula | C26H23FN2O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[3-[6-fluoro-1,1-dioxo-2-(2-phenylethyl)-3H-1,2-benzothiazol-3-yl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2c3ccc(F)cc3S(=O)(=O)N2CCc2ccccc2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C26H23FN2O4S/c1-17-25(20-9-5-6-10-22(20)28(17)16-24(30)31)26-21-12-11-19(27)15-23(21)34(32,33)29(26)14-13-18-7-3-2-4-8-18/h2-12,15,26H,13-14,16H2,1H3,(H,30,31) |
| InChIKey | INYQOLGUUDNFRD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|