C23H19F3N6OS — CID 11627206
4-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzonitrile (PubChem CID 11627206) has the molecular formula C23H19F3N6OS and a molecular weight of 484.51 g/mol. Its IUPAC name is 4-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzonitrile.
| Compound Name | 4-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzonitrile |
|---|---|
| PubChem CID | 11627206 |
| Molecular Formula | C23H19F3N6OS |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 4-[6-ethoxy-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]benzonitrile |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(C#N)cc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C23H19F3N6OS/c1-2-33-20-19-18(30-22(31-20)32-9-7-28-8-10-32)17-15(23(24,25)26)11-16(29-21(17)34-19)14-5-3-13(12-27)4-6-14/h3-6,11,28H,2,7-10H2,1H3 |
| InChIKey | PZBYEKXNMPGOJI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |