C24H32Cl2N6O — CID 11627318
1-(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-3-(2,6-dichloro-4-pyridinyl)-1-[3-(4-methylpiperazin-1-yl)propyl]urea (PubChem CID 11627318) has the molecular formula C24H32Cl2N6O and a molecular weight of 491.47 g/mol. Its IUPAC name is 1-(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-3-(2,6-dichloro-4-pyridinyl)-1-[3-(4-methylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-3-(2,6-dichloro-4-pyridinyl)-1-[3-(4-methylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 11627318 |
| Molecular Formula | C24H32Cl2N6O |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 1-(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-3-(2,6-dichloro-4-pyridinyl)-1-[3-(4-methylpiperazin-1-yl)propyl]urea |
| SMILES | CN1CCN(CCCN(C(=O)Nc2cc(Cl)nc(Cl)c2)C2CCc3ccc(N)cc3C2)CC1 |
| InChI | InChI=1S/C24H32Cl2N6O/c1-30-9-11-31(12-10-30)7-2-8-32(24(33)28-20-15-22(25)29-23(26)16-20)21-6-4-17-3-5-19(27)13-18(17)14-21/h3,5,13,15-16,21H,2,4,6-12,14,27H2,1H3,(H,28,29,33) |
| InChIKey | GAKDCKMIRJFEKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|