C22H23F4N5O4 — CID 11627406
N-[5-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-2-(trifluoromethoxy)phenyl]-2-(2-fluoroethylamino)acetamide (PubChem CID 11627406) has the molecular formula C22H23F4N5O4 and a molecular weight of 497.45 g/mol. Its IUPAC name is N-[5-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-2-(trifluoromethoxy)phenyl]-2-(2-fluoroethylamino)acetamide.
| Compound Name | N-[5-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-2-(trifluoromethoxy)phenyl]-2-(2-fluoroethylamino)acetamide |
|---|---|
| PubChem CID | 11627406 |
| Molecular Formula | C22H23F4N5O4 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[5-[4,4-dimethyl-2,5-dioxo-3-(pyridin-4-ylmethyl)imidazolidin-1-yl]-2-(trifluoromethoxy)phenyl]-2-(2-fluoroethylamino)acetamide |
| SMILES | CC1(C)C(=O)N(c2ccc(OC(F)(F)F)c(NC(=O)CNCCF)c2)C(=O)N1Cc1ccncc1 |
| InChI | InChI=1S/C22H23F4N5O4/c1-21(2)19(33)31(20(34)30(21)13-14-5-8-27-9-6-14)15-3-4-17(35-22(24,25)26)16(11-15)29-18(32)12-28-10-7-23/h3-6,8-9,11,28H,7,10,12-13H2,1-2H3,(H,29,32) |
| InChIKey | ZCZQEGCFDOUTKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|