C34H42N2O2 — CID 11627627
(1S,3E,7E,9S,11E,13S,16S,17R,18S)-16-ethyl-18-[(1R)-1-(1H-indol-3-yl)ethyl]-7,9,15-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11,14-tetraene-2,20-dione (PubChem CID 11627627) has the molecular formula C34H42N2O2 and a molecular weight of 510.72 g/mol. Its IUPAC name is (1S,3E,7E,9S,11E,13S,16S,17R,18S)-16-ethyl-18-[(1R)-1-(1H-indol-3-yl)ethyl]-7,9,15-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11,14-tetraene-2,20-dione.
| Compound Name | (1S,3E,7E,9S,11E,13S,16S,17R,18S)-16-ethyl-18-[(1R)-1-(1H-indol-3-yl)ethyl]-7,9,15-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11,14-tetraene-2,20-dione |
|---|---|
| PubChem CID | 11627627 |
| Molecular Formula | C34H42N2O2 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | (1S,3E,7E,9S,11E,13S,16S,17R,18S)-16-ethyl-18-[(1R)-1-(1H-indol-3-yl)ethyl]-7,9,15-trimethyl-19-azatricyclo[11.7.0.01,17]icosa-3,7,11,14-tetraene-2,20-dione |
| SMILES | CC[C@@H]1C(C)=C[C@@H]2/C=C/C[C@H](C)/C=C(\C)CC/C=C/C(=O)[C@]23C(=O)N[C@@H]([C@H](C)c2c[nH]c4ccccc24)[C@H]13 |
| InChI | InChI=1S/C34H42N2O2/c1-6-26-23(4)19-25-14-11-13-22(3)18-21(2)12-7-10-17-30(37)34(25)31(26)32(36-33(34)38)24(5)28-20-35-29-16-9-8-15-27(28)29/h8-11,14-20,22,24-26,31-32,35H,6-7,12-13H2,1-5H3,(H,36,38)/b14-11+,17-10+,21-18+/t22-,24+,25-,26+,31-,32-,34+/m0/s1 |
| InChIKey | MMDCZRJSKCICND-PYZWPHHPSA-N |
| XLogP | 7.42 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|