C32H37NO6 — CID 11627926
(4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid (PubChem CID 11627926) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11627926 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol;2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CC2CCCC2=O)cc1.CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C17H19NO3.C15H18O3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h2-5,10-11,13,16,19-20H,6-8H2,1H3;5-8,10,13H,2-4,9H2,1H3,(H,17,18)/t10-,11+,13-,16-,17-;/m0./s1 |
| InChIKey | KKXRBYZGHGJSEN-VYKNHSEDSA-N |
| XLogP | 3.98 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|